C14H6Br6N2O2 — CID 89438715
N,N'-bis(2,4,6-tribromophenyl)oxamide (PubChem CID 89438715) has the molecular formula C14H6Br6N2O2 and a molecular weight of 713.64 g/mol. Its IUPAC name is N,N'-bis(2,4,6-tribromophenyl)oxamide.
| Compound Name | N,N'-bis(2,4,6-tribromophenyl)oxamide |
|---|---|
| PubChem CID | 89438715 |
| Molecular Formula | C14H6Br6N2O2 |
| Molecular Weight | 713.64 g/mol |
| Exact Mass | 707.55 |
| IUPAC Name | N,N'-bis(2,4,6-tribromophenyl)oxamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)C(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H6Br6N2O2/c15-5-1-7(17)11(8(18)2-5)21-13(23)14(24)22-12-9(19)3-6(16)4-10(12)20/h1-4H,(H,21,23)(H,22,24) |
| InChIKey | NFEANVKURIPRMI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|