C7H5Br3N2O — CID 28991940
(2,4,6-tribromophenyl)urea (PubChem CID 28991940) has the molecular formula C7H5Br3N2O and a molecular weight of 372.84 g/mol. Its IUPAC name is (2,4,6-tribromophenyl)urea.
| Compound Name | (2,4,6-tribromophenyl)urea |
|---|---|
| PubChem CID | 28991940 |
| Molecular Formula | C7H5Br3N2O |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 369.80 |
| IUPAC Name | (2,4,6-tribromophenyl)urea |
| SMILES | NC(=O)Nc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C7H5Br3N2O/c8-3-1-4(9)6(5(10)2-3)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | JABLEDMKPFSPJU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |