C20H7Br9N2O2 — CID 101287009
4,5,6-tribromo-1-N,3-N-bis(2,4,6-tribromophenyl)benzene-1,3-dicarboxamide (PubChem CID 101287009) has the molecular formula C20H7Br9N2O2 and a molecular weight of 1026.42 g/mol. Its IUPAC name is 4,5,6-tribromo-1-N,3-N-bis(2,4,6-tribromophenyl)benzene-1,3-dicarboxamide.
| Compound Name | 4,5,6-tribromo-1-N,3-N-bis(2,4,6-tribromophenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 101287009 |
| Molecular Formula | C20H7Br9N2O2 |
| Molecular Weight | 1026.42 g/mol |
| Exact Mass | 1017.32 |
| IUPAC Name | 4,5,6-tribromo-1-N,3-N-bis(2,4,6-tribromophenyl)benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)c1cc(C(=O)Nc2c(Br)cc(Br)cc2Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C20H7Br9N2O2/c21-6-1-10(23)17(11(24)2-6)30-19(32)8-5-9(15(28)16(29)14(8)27)20(33)31-18-12(25)3-7(22)4-13(18)26/h1-5H,(H,30,32)(H,31,33) |
| InChIKey | BYQJWTWYJYLAGB-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.42 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|