C14H4Br3F4NO3 — CID 162705163
2,3,5,6-tetrafluoro-4-[(2,3,5-tribromobenzoyl)amino]benzoic acid (PubChem CID 162705163) has the molecular formula C14H4Br3F4NO3 and a molecular weight of 549.89 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(2,3,5-tribromobenzoyl)amino]benzoic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(2,3,5-tribromobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 162705163 |
| Molecular Formula | C14H4Br3F4NO3 |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 546.77 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(2,3,5-tribromobenzoyl)amino]benzoic acid |
| SMILES | O=C(Nc1c(F)c(F)c(C(=O)O)c(F)c1F)c1cc(Br)cc(Br)c1Br |
| InChI | InChI=1S/C14H4Br3F4NO3/c15-3-1-4(7(17)5(16)2-3)13(23)22-12-10(20)8(18)6(14(24)25)9(19)11(12)21/h1-2H,(H,22,23)(H,24,25) |
| InChIKey | DYKUOBHEJDEZLJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|