C14H9Br3FNO — CID 62509199
2-fluoro-5-methyl-N-(2,4,6-tribromophenyl)benzamide (PubChem CID 62509199) has the molecular formula C14H9Br3FNO and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(2,4,6-tribromophenyl)benzamide.
| Compound Name | 2-fluoro-5-methyl-N-(2,4,6-tribromophenyl)benzamide |
|---|---|
| PubChem CID | 62509199 |
| Molecular Formula | C14H9Br3FNO |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 462.82 |
| IUPAC Name | 2-fluoro-5-methyl-N-(2,4,6-tribromophenyl)benzamide |
| SMILES | Cc1ccc(F)c(C(=O)Nc2c(Br)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C14H9Br3FNO/c1-7-2-3-12(18)9(4-7)14(20)19-13-10(16)5-8(15)6-11(13)17/h2-6H,1H3,(H,19,20) |
| InChIKey | IAIBBQYMIRYEQO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |