C13H6Br4FNO — CID 43126410
4-bromo-2-fluoro-N-(2,4,6-tribromophenyl)benzamide (PubChem CID 43126410) has the molecular formula C13H6Br4FNO and a molecular weight of 530.81 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(2,4,6-tribromophenyl)benzamide.
| Compound Name | 4-bromo-2-fluoro-N-(2,4,6-tribromophenyl)benzamide |
|---|---|
| PubChem CID | 43126410 |
| Molecular Formula | C13H6Br4FNO |
| Molecular Weight | 530.81 g/mol |
| Exact Mass | 526.72 |
| IUPAC Name | 4-bromo-2-fluoro-N-(2,4,6-tribromophenyl)benzamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H6Br4FNO/c14-6-1-2-8(11(18)5-6)13(20)19-12-9(16)3-7(15)4-10(12)17/h1-5H,(H,19,20) |
| InChIKey | GGAZIAKHPCMDLC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.81 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |