C13H8Br3NO3 — CID 114343907
2,3-dihydroxy-N-(2,4,6-tribromophenyl)benzamide (PubChem CID 114343907) has the molecular formula C13H8Br3NO3 and a molecular weight of 465.92 g/mol. Its IUPAC name is 2,3-dihydroxy-N-(2,4,6-tribromophenyl)benzamide.
| Compound Name | 2,3-dihydroxy-N-(2,4,6-tribromophenyl)benzamide |
|---|---|
| PubChem CID | 114343907 |
| Molecular Formula | C13H8Br3NO3 |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 462.81 |
| IUPAC Name | 2,3-dihydroxy-N-(2,4,6-tribromophenyl)benzamide |
| SMILES | O=C(Nc1c(Br)cc(Br)cc1Br)c1cccc(O)c1O |
| InChI | InChI=1S/C13H8Br3NO3/c14-6-4-8(15)11(9(16)5-6)17-13(20)7-2-1-3-10(18)12(7)19/h1-5,18-19H,(H,17,20) |
| InChIKey | QKRHMDRPZFDAIM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|