C13H7BrF3NO — CID 65470097
N-(4-bromo-2,6-difluorophenyl)-2-fluorobenzamide (PubChem CID 65470097) has the molecular formula C13H7BrF3NO and a molecular weight of 330.10 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2-fluorobenzamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 65470097 |
| Molecular Formula | C13H7BrF3NO |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2-fluorobenzamide |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)c1ccccc1F |
| InChI | InChI=1S/C13H7BrF3NO/c14-7-5-10(16)12(11(17)6-7)18-13(19)8-3-1-2-4-9(8)15/h1-6H,(H,18,19) |
| InChIKey | RRBPNALSKAJBAT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |