C13H10BrF2N3O — CID 65469243
2,4-diamino-N-(4-bromo-2,6-difluorophenyl)benzamide (PubChem CID 65469243) has the molecular formula C13H10BrF2N3O and a molecular weight of 342.14 g/mol. Its IUPAC name is 2,4-diamino-N-(4-bromo-2,6-difluorophenyl)benzamide.
| Compound Name | 2,4-diamino-N-(4-bromo-2,6-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 65469243 |
| Molecular Formula | C13H10BrF2N3O |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2,4-diamino-N-(4-bromo-2,6-difluorophenyl)benzamide |
| SMILES | Nc1ccc(C(=O)Nc2c(F)cc(Br)cc2F)c(N)c1 |
| InChI | InChI=1S/C13H10BrF2N3O/c14-6-3-9(15)12(10(16)4-6)19-13(20)8-2-1-7(17)5-11(8)18/h1-5H,17-18H2,(H,19,20) |
| InChIKey | DUSYJHOJKKHSNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|