C17H17BrFNO — CID 26692195
4-bromo-N-(2,6-diethylphenyl)-2-fluorobenzamide (PubChem CID 26692195) has the molecular formula C17H17BrFNO and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-bromo-N-(2,6-diethylphenyl)-2-fluorobenzamide.
| Compound Name | 4-bromo-N-(2,6-diethylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 26692195 |
| Molecular Formula | C17H17BrFNO |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-bromo-N-(2,6-diethylphenyl)-2-fluorobenzamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C17H17BrFNO/c1-3-11-6-5-7-12(4-2)16(11)20-17(21)14-9-8-13(18)10-15(14)19/h5-10H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | BNIKJMAADSXMTQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |