C20H9BrF7NO — CID 56647411
5-bromo-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide (PubChem CID 56647411) has the molecular formula C20H9BrF7NO and a molecular weight of 492.19 g/mol. Its IUPAC name is 5-bromo-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 56647411 |
| Molecular Formula | C20H9BrF7NO |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 490.98 |
| IUPAC Name | 5-bromo-2-phenyl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1cc(Br)ccc1-c1ccccc1 |
| InChI | InChI=1S/C20H9BrF7NO/c21-10-6-7-11(9-4-2-1-3-5-9)12(8-10)19(30)29-18-16(24)14(22)13(20(26,27)28)15(23)17(18)25/h1-8H,(H,29,30) |
| InChIKey | IEFNEWIAGDQXFC-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|