C23H23F7N2O — CID 135058197
4-tert-butyl-2-piperidin-1-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide (PubChem CID 135058197) has the molecular formula C23H23F7N2O and a molecular weight of 476.44 g/mol. Its IUPAC name is 4-tert-butyl-2-piperidin-1-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-tert-butyl-2-piperidin-1-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 135058197 |
| Molecular Formula | C23H23F7N2O |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 4-tert-butyl-2-piperidin-1-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(N2CCCCC2)c1 |
| InChI | InChI=1S/C23H23F7N2O/c1-22(2,3)12-7-8-13(14(11-12)32-9-5-4-6-10-32)21(33)31-20-18(26)16(24)15(23(28,29)30)17(25)19(20)27/h7-8,11H,4-6,9-10H2,1-3H3,(H,31,33) |
| InChIKey | TUFOLAXDZBFMLX-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|