C16H11F7N2O2S — CID 102110185
3-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 102110185) has the molecular formula C16H11F7N2O2S and a molecular weight of 428.33 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 102110185 |
| Molecular Formula | C16H11F7N2O2S |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 3-morpholin-4-yl-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F)c1sccc1N1CCOCC1 |
| InChI | InChI=1S/C16H11F7N2O2S/c17-9-8(16(21,22)23)10(18)12(20)13(11(9)19)24-15(26)14-7(1-6-28-14)25-2-4-27-5-3-25/h1,6H,2-5H2,(H,24,26) |
| InChIKey | LNAZUUXSTVOENS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|