C9H12ClNO3S — CID 142792123
3-morpholin-4-ylthiophene-2-carboxylic acid;hydrochloride (PubChem CID 142792123) has the molecular formula C9H12ClNO3S and a molecular weight of 249.72 g/mol. Its IUPAC name is 3-morpholin-4-ylthiophene-2-carboxylic acid;hydrochloride.
| Compound Name | 3-morpholin-4-ylthiophene-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 142792123 |
| Molecular Formula | C9H12ClNO3S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 3-morpholin-4-ylthiophene-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1sccc1N1CCOCC1 |
| InChI | InChI=1S/C9H11NO3S.ClH/c11-9(12)8-7(1-6-14-8)10-2-4-13-5-3-10;/h1,6H,2-5H2,(H,11,12);1H |
| InChIKey | QJRNUSNNQJQRQH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |