C16H16N2O4S — CID 783853
2-morpholin-4-yl-5-(thiophene-2-carbonylamino)benzoic acid (PubChem CID 783853) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-morpholin-4-yl-5-(thiophene-2-carbonylamino)benzoic acid.
| Compound Name | 2-morpholin-4-yl-5-(thiophene-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 783853 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-morpholin-4-yl-5-(thiophene-2-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(C(=O)O)c1)c1cccs1 |
| InChI | InChI=1S/C16H16N2O4S/c19-15(14-2-1-9-23-14)17-11-3-4-13(12(10-11)16(20)21)18-5-7-22-8-6-18/h1-4,9-10H,5-8H2,(H,17,19)(H,20,21) |
| InChIKey | BDSZSMQHPDDILC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|