C21H20ClN3O4S2 — CID 4626135
N-[5-[(4-chlorophenyl)sulfamoyl]-2-morpholin-4-ylphenyl]thiophene-2-carboxamide (PubChem CID 4626135) has the molecular formula C21H20ClN3O4S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)sulfamoyl]-2-morpholin-4-ylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[(4-chlorophenyl)sulfamoyl]-2-morpholin-4-ylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4626135 |
| Molecular Formula | C21H20ClN3O4S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | N-[5-[(4-chlorophenyl)sulfamoyl]-2-morpholin-4-ylphenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)Nc2ccc(Cl)cc2)ccc1N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C21H20ClN3O4S2/c22-15-3-5-16(6-4-15)24-31(27,28)17-7-8-19(25-9-11-29-12-10-25)18(14-17)23-21(26)20-2-1-13-30-20/h1-8,13-14,24H,9-12H2,(H,23,26) |
| InChIKey | RMUAQDMCXZWNHV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |