C24H26N4O5S — CID 4185237
1-[5-[(4-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-phenylurea (PubChem CID 4185237) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 1-[5-[(4-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-phenylurea.
| Compound Name | 1-[5-[(4-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 4185237 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 1-[5-[(4-methoxyphenyl)sulfamoyl]-2-morpholin-4-ylphenyl]-3-phenylurea |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(N3CCOCC3)c(NC(=O)Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H26N4O5S/c1-32-20-9-7-19(8-10-20)27-34(30,31)21-11-12-23(28-13-15-33-16-14-28)22(17-21)26-24(29)25-18-5-3-2-4-6-18/h2-12,17,27H,13-16H2,1H3,(H2,25,26,29) |
| InChIKey | WKIFMAACRIDWKV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |