C25H26FN3O5S — CID 3933606
2-(2-fluorophenyl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]acetamide (PubChem CID 3933606) has the molecular formula C25H26FN3O5S and a molecular weight of 499.56 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]acetamide |
|---|---|
| PubChem CID | 3933606 |
| Molecular Formula | C25H26FN3O5S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)Cc3ccccc3F)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H26FN3O5S/c1-33-21-9-6-19(7-10-21)28-35(31,32)24-17-20(8-11-23(24)29-12-14-34-15-13-29)27-25(30)16-18-4-2-3-5-22(18)26/h2-11,17,28H,12-16H2,1H3,(H,27,30) |
| InChIKey | FFRZGUJMSQLGHS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|