C27H27N5O6S — CID 3948396
2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]acetamide (PubChem CID 3948396) has the molecular formula C27H27N5O6S and a molecular weight of 549.61 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]acetamide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]acetamide |
|---|---|
| PubChem CID | 3948396 |
| Molecular Formula | C27H27N5O6S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)Cn3[nH]c(=O)c4ccccc4c3=O)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C27H27N5O6S/c1-38-20-11-8-18(9-12-20)30-39(36,37)24-16-19(10-13-23(24)31-14-4-5-15-31)28-25(33)17-32-27(35)22-7-3-2-6-21(22)26(34)29-32/h2-3,6-13,16,30H,4-5,14-15,17H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | IDJNRASHCJYNSV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 142.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|