C23H26N4O6S — CID 22109680
N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-2-[(5-methyl-1,2-oxazol-3-yl)oxy]acetamide (PubChem CID 22109680) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-2-[(5-methyl-1,2-oxazol-3-yl)oxy]acetamide.
| Compound Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-2-[(5-methyl-1,2-oxazol-3-yl)oxy]acetamide |
|---|---|
| PubChem CID | 22109680 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[3-[(4-methoxyphenyl)sulfamoyl]-4-pyrrolidin-1-ylphenyl]-2-[(5-methyl-1,2-oxazol-3-yl)oxy]acetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)COc3cc(C)on3)ccc2N2CCCC2)cc1 |
| InChI | InChI=1S/C23H26N4O6S/c1-16-13-23(25-33-16)32-15-22(28)24-18-7-10-20(27-11-3-4-12-27)21(14-18)34(29,30)26-17-5-8-19(31-2)9-6-17/h5-10,13-14,26H,3-4,11-12,15H2,1-2H3,(H,24,28) |
| InChIKey | UTMVGQCKEZVBEU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|