C22H29N5O5S — CID 24634722
2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]propanamide (PubChem CID 24634722) has the molecular formula C22H29N5O5S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]propanamide.
| Compound Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]propanamide |
|---|---|
| PubChem CID | 24634722 |
| Molecular Formula | C22H29N5O5S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-piperidin-1-ylphenyl]propanamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C(C)NC(N)=O)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H29N5O5S/c1-15(24-22(23)29)21(28)25-17-8-11-19(27-12-4-3-5-13-27)20(14-17)33(30,31)26-16-6-9-18(32-2)10-7-16/h6-11,14-15,26H,3-5,12-13H2,1-2H3,(H,25,28)(H3,23,24,29) |
| InChIKey | CPUPVMHKIMPSLM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|