C20H26N4O5S — CID 3383117
2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-methylbutanamide (PubChem CID 3383117) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-methylbutanamide.
| Compound Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3383117 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-(carbamoylamino)-N-[3-[(4-methoxyphenyl)sulfamoyl]-4-methylphenyl]-3-methylbutanamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C(NC(N)=O)C(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C20H26N4O5S/c1-12(2)18(23-20(21)26)19(25)22-15-6-5-13(3)17(11-15)30(27,28)24-14-7-9-16(29-4)10-8-14/h5-12,18,24H,1-4H3,(H,22,25)(H3,21,23,26) |
| InChIKey | PSYPTSGXEOFUKM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |