C20H25BrN4O4S — CID 24636258
N-[3-[(4-bromophenyl)sulfamoyl]-4-methylphenyl]-2-(carbamoylamino)-3-methylpentanamide (PubChem CID 24636258) has the molecular formula C20H25BrN4O4S and a molecular weight of 497.42 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)sulfamoyl]-4-methylphenyl]-2-(carbamoylamino)-3-methylpentanamide.
| Compound Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methylphenyl]-2-(carbamoylamino)-3-methylpentanamide |
|---|---|
| PubChem CID | 24636258 |
| Molecular Formula | C20H25BrN4O4S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | N-[3-[(4-bromophenyl)sulfamoyl]-4-methylphenyl]-2-(carbamoylamino)-3-methylpentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1ccc(C)c(S(=O)(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C20H25BrN4O4S/c1-4-12(2)18(24-20(22)27)19(26)23-16-8-5-13(3)17(11-16)30(28,29)25-15-9-6-14(21)7-10-15/h5-12,18,25H,4H2,1-3H3,(H,23,26)(H3,22,24,27) |
| InChIKey | GMTLHWYCTYMEIN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |