C18H22N4O6S — CID 18208108
2-(carbamoylamino)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]propanamide (PubChem CID 18208108) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | 2-(carbamoylamino)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 18208108 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-(carbamoylamino)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]propanamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)C(C)NC(N)=O)ccc2OC)cc1 |
| InChI | InChI=1S/C18H22N4O6S/c1-11(20-18(19)24)17(23)21-13-6-9-15(28-3)16(10-13)29(25,26)22-12-4-7-14(27-2)8-5-12/h4-11,22H,1-3H3,(H,21,23)(H3,19,20,24) |
| InChIKey | VWJBRSVYWUCKNL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |