C17H20N2O5S2 — CID 4788054
N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylsulfanylacetamide (PubChem CID 4788054) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylsulfanylacetamide.
| Compound Name | N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylsulfanylacetamide |
|---|---|
| PubChem CID | 4788054 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-2-methylsulfanylacetamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(NC(=O)CSC)ccc2OC)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-23-14-7-4-12(5-8-14)19-26(21,22)16-10-13(6-9-15(16)24-2)18-17(20)11-25-3/h4-10,19H,11H2,1-3H3,(H,18,20) |
| InChIKey | JAHGRPHAIWJCQJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |