C26H28N2O7S — CID 4851333
4-(4-ethoxyphenyl)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide (PubChem CID 4851333) has the molecular formula C26H28N2O7S and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide.
| Compound Name | 4-(4-ethoxyphenyl)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4851333 |
| Molecular Formula | C26H28N2O7S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-[4-methoxy-3-[(4-methoxyphenyl)sulfamoyl]phenyl]-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)Nc2ccc(OC)c(S(=O)(=O)Nc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C26H28N2O7S/c1-4-35-22-10-5-18(6-11-22)23(29)14-16-26(30)27-20-9-15-24(34-3)25(17-20)36(31,32)28-19-7-12-21(33-2)13-8-19/h5-13,15,17,28H,4,14,16H2,1-3H3,(H,27,30) |
| InChIKey | WIDVLVWKHYMVTC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |