C23H31N3O7S — CID 26259494
tert-butyl N-[3-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyanilino]-3-oxopropyl]carbamate (PubChem CID 26259494) has the molecular formula C23H31N3O7S and a molecular weight of 493.58 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyanilino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyanilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 26259494 |
| Molecular Formula | C23H31N3O7S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | tert-butyl N-[3-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyanilino]-3-oxopropyl]carbamate |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)CCNC(=O)OC(C)(C)C)ccc2OC)cc1 |
| InChI | InChI=1S/C23H31N3O7S/c1-6-32-18-10-7-16(8-11-18)26-34(29,30)20-15-17(9-12-19(20)31-5)25-21(27)13-14-24-22(28)33-23(2,3)4/h7-12,15,26H,6,13-14H2,1-5H3,(H,24,28)(H,25,27) |
| InChIKey | DEVQLPPTHKKTIB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |