C20H31N3O6S — CID 31361726
tert-butyl N-[3-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-3-oxopropyl]carbamate (PubChem CID 31361726) has the molecular formula C20H31N3O6S and a molecular weight of 441.55 g/mol. Its IUPAC name is tert-butyl N-[3-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 31361726 |
| Molecular Formula | C20H31N3O6S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | tert-butyl N-[3-(4-ethoxy-3-pyrrolidin-1-ylsulfonylanilino)-3-oxopropyl]carbamate |
| SMILES | CCOc1ccc(NC(=O)CCNC(=O)OC(C)(C)C)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C20H31N3O6S/c1-5-28-16-9-8-15(14-17(16)30(26,27)23-12-6-7-13-23)22-18(24)10-11-21-19(25)29-20(2,3)4/h8-9,14H,5-7,10-13H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | LVLAUQPWTJGIGN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |