C25H28N2O7S2 — CID 3484295
N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 3484295) has the molecular formula C25H28N2O7S2 and a molecular weight of 532.64 g/mol. Its IUPAC name is N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 3484295 |
| Molecular Formula | C25H28N2O7S2 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[3-[(4-ethoxyphenyl)sulfamoyl]-4-methoxyphenyl]-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2cc(NC(=O)CCS(=O)(=O)c3ccc(C)cc3)ccc2OC)cc1 |
| InChI | InChI=1S/C25H28N2O7S2/c1-4-34-21-10-7-19(8-11-21)27-36(31,32)24-17-20(9-14-23(24)33-3)26-25(28)15-16-35(29,30)22-12-5-18(2)6-13-22/h5-14,17,27H,4,15-16H2,1-3H3,(H,26,28) |
| InChIKey | RWKJJOKVBQFFER-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |