C20H25NO5S — CID 4101955
N-(2,5-diethoxyphenyl)-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 4101955) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N-(2,5-diethoxyphenyl)-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 4101955 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-25-16-8-11-19(26-5-2)18(14-16)21-20(22)12-13-27(23,24)17-9-6-15(3)7-10-17/h6-11,14H,4-5,12-13H2,1-3H3,(H,21,22) |
| InChIKey | DIPGCWHVDRCTRN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |