C13H19NO4 — CID 34737899
N-(2,5-diethoxyphenyl)-2-methoxyacetamide (PubChem CID 34737899) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-methoxyacetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 34737899 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-methoxyacetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)COC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-4-17-10-6-7-12(18-5-2)11(8-10)14-13(15)9-16-3/h6-8H,4-5,9H2,1-3H3,(H,14,15) |
| InChIKey | BGIRHYRJYBACKO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |