C20H22BrNO6 — CID 42236291
[2-(2,5-diethoxyanilino)-2-oxoethyl] 2-bromo-5-methoxybenzoate (PubChem CID 42236291) has the molecular formula C20H22BrNO6 and a molecular weight of 452.30 g/mol. Its IUPAC name is [2-(2,5-diethoxyanilino)-2-oxoethyl] 2-bromo-5-methoxybenzoate.
| Compound Name | [2-(2,5-diethoxyanilino)-2-oxoethyl] 2-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 42236291 |
| Molecular Formula | C20H22BrNO6 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | [2-(2,5-diethoxyanilino)-2-oxoethyl] 2-bromo-5-methoxybenzoate |
| SMILES | CCOc1ccc(OCC)c(NC(=O)COC(=O)c2cc(OC)ccc2Br)c1 |
| InChI | InChI=1S/C20H22BrNO6/c1-4-26-14-7-9-18(27-5-2)17(11-14)22-19(23)12-28-20(24)15-10-13(25-3)6-8-16(15)21/h6-11H,4-5,12H2,1-3H3,(H,22,23) |
| InChIKey | MWKNZRZEZJZWBM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |