C21H27NO4 — CID 31526543
N-(2,5-diethoxyphenyl)-3-(2,5-dimethylphenoxy)propanamide (PubChem CID 31526543) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-3-(2,5-dimethylphenoxy)propanamide.
| Compound Name | N-(2,5-diethoxyphenyl)-3-(2,5-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 31526543 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-3-(2,5-dimethylphenoxy)propanamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CCOc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C21H27NO4/c1-5-24-17-9-10-19(25-6-2)18(14-17)22-21(23)11-12-26-20-13-15(3)7-8-16(20)4/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,22,23) |
| InChIKey | GKCDHNIUJCKZNV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |