C16H19N3O5S — CID 46518710
1-[4-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]-3-methylurea (PubChem CID 46518710) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[4-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]-3-methylurea.
| Compound Name | 1-[4-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 46518710 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-[4-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(NS(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C16H19N3O5S/c1-17-16(20)18-11-4-6-12(7-5-11)19-25(21,22)15-10-13(23-2)8-9-14(15)24-3/h4-10,19H,1-3H3,(H2,17,18,20) |
| InChIKey | OASBWHMHEMQPMP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |