C16H18N2O6S — CID 71890321
methyl N-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]carbamate (PubChem CID 71890321) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is methyl N-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]carbamate.
| Compound Name | methyl N-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 71890321 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | methyl N-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NS(=O)(=O)c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C16H18N2O6S/c1-22-13-7-8-14(23-2)15(10-13)25(20,21)18-12-6-4-5-11(9-12)17-16(19)24-3/h4-10,18H,1-3H3,(H,17,19) |
| InChIKey | BSOYZAASOUEJCP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |