C18H21NO7S — CID 46547637
ethyl 2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenoxy]acetate (PubChem CID 46547637) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is ethyl 2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenoxy]acetate.
| Compound Name | ethyl 2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 46547637 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | ethyl 2-[3-[(2,5-dimethoxyphenyl)sulfonylamino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cccc(NS(=O)(=O)c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C18H21NO7S/c1-4-25-18(20)12-26-15-7-5-6-13(10-15)19-27(21,22)17-11-14(23-2)8-9-16(17)24-3/h5-11,19H,4,12H2,1-3H3 |
| InChIKey | ZSRZNQKILLKHEZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |