C11H15KO7S — CID 173316311
potassium;4-(2-ethoxy-2-oxoethoxy)-2-methoxybenzenesulfonic acid;hydride (PubChem CID 173316311) has the molecular formula C11H15KO7S and a molecular weight of 330.40 g/mol. Its IUPAC name is potassium;4-(2-ethoxy-2-oxoethoxy)-2-methoxybenzenesulfonic acid;hydride.
| Compound Name | potassium;4-(2-ethoxy-2-oxoethoxy)-2-methoxybenzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173316311 |
| Molecular Formula | C11H15KO7S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | potassium;4-(2-ethoxy-2-oxoethoxy)-2-methoxybenzenesulfonic acid;hydride |
| SMILES | CCOC(=O)COc1ccc(S(=O)(=O)O)c(OC)c1.[H-].[K+] |
| InChI | InChI=1S/C11H14O7S.K.H/c1-3-17-11(12)7-18-8-4-5-10(19(13,14)15)9(6-8)16-2;;/h4-6H,3,7H2,1-2H3,(H,13,14,15);;/q;+1;-1 |
| InChIKey | USUPKGFFRHKCRW-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|