C18H24O9 — CID 71361550
ethyl 2-[3,5-bis(2-ethoxy-2-oxoethoxy)phenoxy]acetate (PubChem CID 71361550) has the molecular formula C18H24O9 and a molecular weight of 384.38 g/mol. Its IUPAC name is ethyl 2-[3,5-bis(2-ethoxy-2-oxoethoxy)phenoxy]acetate.
| Compound Name | ethyl 2-[3,5-bis(2-ethoxy-2-oxoethoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 71361550 |
| Molecular Formula | C18H24O9 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 2-[3,5-bis(2-ethoxy-2-oxoethoxy)phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(OCC(=O)OCC)cc(OCC(=O)OCC)c1 |
| InChI | InChI=1S/C18H24O9/c1-4-22-16(19)10-25-13-7-14(26-11-17(20)23-5-2)9-15(8-13)27-12-18(21)24-6-3/h7-9H,4-6,10-12H2,1-3H3 |
| InChIKey | PPVWYXMYZXBZRZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|