About ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate
ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate (PubChem CID 144648402) has the molecular formula C27H38O6
and a molecular weight of 458.60 g/mol. Its IUPAC name is ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate.
Molecular Properties
| Compound Name | ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate |
| PubChem CID | 144648402 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate |
| SMILES | CC.CCCCCc1ccc(-c2cc(OCC(=O)OCC)cc(OCC(=O)OCC)c2)cc1 |
| InChI | InChI=1S/C25H32O6.C2H6/c1-4-7-8-9-19-10-12-20(13-11-19)21-14-22(30-17-24(26)28-5-2)16-23(15-21)31-18-25(27)29-6-3;1-2/h10-16H,4-9,17-18H2,1-3H3;1-2H3 |
| InChIKey | KHTNQGKJMOWIMC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate?
The IUPAC name of ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate (CID 144648402) is ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate.
What is the SMILES notation for ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate?
The canonical SMILES for ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate is CC.CCCCCc1ccc(-c2cc(OCC(=O)OCC)cc(OCC(=O)OCC)c2)cc1.
What is the InChIKey of ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate?
The InChIKey is KHTNQGKJMOWIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32O6.C2H6/c1-4-7-8-9-19-10-12-20(13-11-19)21-14-22(30-17-24(26)28-5-2)16-23(15-21)31-18-25(27)29-6-3;1-2/h10-16H,4-9,17-18H2,1-3H3;1-2H3.
What are the key properties of ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate?
ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate has a molecular weight of 458.60 g/mol, XLogP of 6.00, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[3-(2-ethoxy-2-oxoethoxy)-5-(4-pentylphenyl)phenoxy]acetate is sourced from PubChem (CID 144648402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).