About ethyl (4-pentylphenyl) carbonate
ethyl (4-pentylphenyl) carbonate (PubChem CID 118690159) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is ethyl (4-pentylphenyl) carbonate.
Molecular Properties
| Compound Name | ethyl (4-pentylphenyl) carbonate |
| PubChem CID | 118690159 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | ethyl (4-pentylphenyl) carbonate |
| SMILES | CCCCCc1ccc(OC(=O)OCC)cc1 |
| InChI | InChI=1S/C14H20O3/c1-3-5-6-7-12-8-10-13(11-9-12)17-14(15)16-4-2/h8-11H,3-7H2,1-2H3 |
| InChIKey | UGQSCLRLXXRRAE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4-pentylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4-pentylphenyl) carbonate?
The IUPAC name of ethyl (4-pentylphenyl) carbonate (CID 118690159) is ethyl (4-pentylphenyl) carbonate.
What is the SMILES notation for ethyl (4-pentylphenyl) carbonate?
The canonical SMILES for ethyl (4-pentylphenyl) carbonate is CCCCCc1ccc(OC(=O)OCC)cc1.
What is the InChIKey of ethyl (4-pentylphenyl) carbonate?
The InChIKey is UGQSCLRLXXRRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-3-5-6-7-12-8-10-13(11-9-12)17-14(15)16-4-2/h8-11H,3-7H2,1-2H3.
What are the key properties of ethyl (4-pentylphenyl) carbonate?
ethyl (4-pentylphenyl) carbonate has a molecular weight of 236.31 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4-pentylphenyl) carbonate is sourced from PubChem (CID 118690159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).