About (4-pentylphenyl) 5-phenylpentyl carbonate
(4-pentylphenyl) 5-phenylpentyl carbonate (PubChem CID 118690324) has the molecular formula C23H30O3
and a molecular weight of 354.49 g/mol. Its IUPAC name is (4-pentylphenyl) 5-phenylpentyl carbonate.
Molecular Properties
| Compound Name | (4-pentylphenyl) 5-phenylpentyl carbonate |
| PubChem CID | 118690324 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (4-pentylphenyl) 5-phenylpentyl carbonate |
| SMILES | CCCCCc1ccc(OC(=O)OCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H30O3/c1-2-3-6-11-21-15-17-22(18-16-21)26-23(24)25-19-10-5-9-14-20-12-7-4-8-13-20/h4,7-8,12-13,15-18H,2-3,5-6,9-11,14,19H2,1H3 |
| InChIKey | WGXLWZCSGWLQMU-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-pentylphenyl) 5-phenylpentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-pentylphenyl) 5-phenylpentyl carbonate?
The IUPAC name of (4-pentylphenyl) 5-phenylpentyl carbonate (CID 118690324) is (4-pentylphenyl) 5-phenylpentyl carbonate.
What is the SMILES notation for (4-pentylphenyl) 5-phenylpentyl carbonate?
The canonical SMILES for (4-pentylphenyl) 5-phenylpentyl carbonate is CCCCCc1ccc(OC(=O)OCCCCCc2ccccc2)cc1.
What is the InChIKey of (4-pentylphenyl) 5-phenylpentyl carbonate?
The InChIKey is WGXLWZCSGWLQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O3/c1-2-3-6-11-21-15-17-22(18-16-21)26-23(24)25-19-10-5-9-14-20-12-7-4-8-13-20/h4,7-8,12-13,15-18H,2-3,5-6,9-11,14,19H2,1H3.
What are the key properties of (4-pentylphenyl) 5-phenylpentyl carbonate?
(4-pentylphenyl) 5-phenylpentyl carbonate has a molecular weight of 354.49 g/mol, XLogP of 6.35, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-pentylphenyl) 5-phenylpentyl carbonate is sourced from PubChem (CID 118690324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).