C31H37FO3 — CID 101062327
ethyl 5-[4-[3-fluoro-4-(4-hexylphenyl)phenyl]phenoxy]pentanoate (PubChem CID 101062327) has the molecular formula C31H37FO3 and a molecular weight of 476.63 g/mol. Its IUPAC name is ethyl 5-[4-[3-fluoro-4-(4-hexylphenyl)phenyl]phenoxy]pentanoate.
| Compound Name | ethyl 5-[4-[3-fluoro-4-(4-hexylphenyl)phenyl]phenoxy]pentanoate |
|---|---|
| PubChem CID | 101062327 |
| Molecular Formula | C31H37FO3 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | ethyl 5-[4-[3-fluoro-4-(4-hexylphenyl)phenyl]phenoxy]pentanoate |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OCCCCC(=O)OCC)cc3)cc2F)cc1 |
| InChI | InChI=1S/C31H37FO3/c1-3-5-6-7-10-24-12-14-26(15-13-24)29-21-18-27(23-30(29)32)25-16-19-28(20-17-25)35-22-9-8-11-31(33)34-4-2/h12-21,23H,3-11,22H2,1-2H3 |
| InChIKey | HTQOVKXUUKDUFC-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|