C56H61BrF2O4 — CID 158526207
1-[4-(4-bromobutyl)phenyl]-2-fluoro-4-(4-pentylphenyl)benzene;carbon dioxide;5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pentanoic acid (PubChem CID 158526207) has the molecular formula C56H61BrF2O4 and a molecular weight of 916.00 g/mol. Its IUPAC name is 1-[4-(4-bromobutyl)phenyl]-2-fluoro-4-(4-pentylphenyl)benzene;carbon dioxide;5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pentanoic acid.
| Compound Name | 1-[4-(4-bromobutyl)phenyl]-2-fluoro-4-(4-pentylphenyl)benzene;carbon dioxide;5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 158526207 |
| Molecular Formula | C56H61BrF2O4 |
| Molecular Weight | 916.00 g/mol |
| Exact Mass | 914.37 |
| IUPAC Name | 1-[4-(4-bromobutyl)phenyl]-2-fluoro-4-(4-pentylphenyl)benzene;carbon dioxide;5-[4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]pentanoic acid |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(CCCCBr)cc3)c(F)c2)cc1.CCCCCc1ccc(-c2ccc(-c3ccc(CCCCC(=O)O)cc3)c(F)c2)cc1.O=C=O |
| InChI | InChI=1S/C28H31FO2.C27H30BrF.CO2/c1-2-3-4-7-21-10-14-23(15-11-21)25-18-19-26(27(29)20-25)24-16-12-22(13-17-24)8-5-6-9-28(30)31;1-2-3-4-7-21-9-13-23(14-10-21)25-17-18-26(27(29)20-25)24-15-11-22(12-16-24)8-5-6-19-28;2-1-3/h10-20H,2-9H2,1H3,(H,30,31);9-18,20H,2-8,19H2,1H3; |
| InChIKey | HMUVKWJGVFGJFO-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.00 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|