C37H46F2O2 — CID 70181075
8-[1-[2-fluoro-4-[4-(2-fluoro-4-hexylphenyl)phenyl]phenyl]cyclopentyl]octanoic acid (PubChem CID 70181075) has the molecular formula C37H46F2O2 and a molecular weight of 560.77 g/mol. Its IUPAC name is 8-[1-[2-fluoro-4-[4-(2-fluoro-4-hexylphenyl)phenyl]phenyl]cyclopentyl]octanoic acid.
| Compound Name | 8-[1-[2-fluoro-4-[4-(2-fluoro-4-hexylphenyl)phenyl]phenyl]cyclopentyl]octanoic acid |
|---|---|
| PubChem CID | 70181075 |
| Molecular Formula | C37H46F2O2 |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.35 |
| IUPAC Name | 8-[1-[2-fluoro-4-[4-(2-fluoro-4-hexylphenyl)phenyl]phenyl]cyclopentyl]octanoic acid |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(C4(CCCCCCCC(=O)O)CCCC4)c(F)c3)cc2)c(F)c1 |
| InChI | InChI=1S/C37H46F2O2/c1-2-3-4-8-13-28-15-21-32(34(38)26-28)30-18-16-29(17-19-30)31-20-22-33(35(39)27-31)37(24-11-12-25-37)23-10-7-5-6-9-14-36(40)41/h15-22,26-27H,2-14,23-25H2,1H3,(H,40,41) |
| InChIKey | QHPSMYJYGJZLPI-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|