C28H36FNO4 — CID 68991774
3-[2-[3-fluoro-4-(4-heptylphenyl)phenyl]ethylamino]cyclopentane-1,1-dicarboxylic acid (PubChem CID 68991774) has the molecular formula C28H36FNO4 and a molecular weight of 469.60 g/mol. Its IUPAC name is 3-[2-[3-fluoro-4-(4-heptylphenyl)phenyl]ethylamino]cyclopentane-1,1-dicarboxylic acid.
| Compound Name | 3-[2-[3-fluoro-4-(4-heptylphenyl)phenyl]ethylamino]cyclopentane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 68991774 |
| Molecular Formula | C28H36FNO4 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 3-[2-[3-fluoro-4-(4-heptylphenyl)phenyl]ethylamino]cyclopentane-1,1-dicarboxylic acid |
| SMILES | CCCCCCCc1ccc(-c2ccc(CCNC3CCC(C(=O)O)(C(=O)O)C3)cc2F)cc1 |
| InChI | InChI=1S/C28H36FNO4/c1-2-3-4-5-6-7-20-8-11-22(12-9-20)24-13-10-21(18-25(24)29)15-17-30-23-14-16-28(19-23,26(31)32)27(33)34/h8-13,18,23,30H,2-7,14-17,19H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | KTKWHGZRXOEVAV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|