C25H38F2N2O3 — CID 68988444
3-[(4-decyl-2,3-difluorophenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 68988444) has the molecular formula C25H38F2N2O3 and a molecular weight of 452.59 g/mol. Its IUPAC name is 3-[(4-decyl-2,3-difluorophenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(4-decyl-2,3-difluorophenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 68988444 |
| Molecular Formula | C25H38F2N2O3 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 3-[(4-decyl-2,3-difluorophenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCCCCCCCCCc1ccc(CNC2CCC(C(=O)O)(C(=O)NC)C2)c(F)c1F |
| InChI | InChI=1S/C25H38F2N2O3/c1-3-4-5-6-7-8-9-10-11-18-12-13-19(22(27)21(18)26)17-29-20-14-15-25(16-20,24(31)32)23(30)28-2/h12-13,20,29H,3-11,14-17H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | VRSWWYHLIPOFEI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|