About 2,3-difluoro-4-hexylphenol
2,3-difluoro-4-hexylphenol (PubChem CID 19910978) has the molecular formula C12H16F2O
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,3-difluoro-4-hexylphenol.
Molecular Properties
| Compound Name | 2,3-difluoro-4-hexylphenol |
| PubChem CID | 19910978 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2,3-difluoro-4-hexylphenol |
| SMILES | CCCCCCc1ccc(O)c(F)c1F |
| InChI | InChI=1S/C12H16F2O/c1-2-3-4-5-6-9-7-8-10(15)12(14)11(9)13/h7-8,15H,2-6H2,1H3 |
| InChIKey | CRSQDBKLCIBFMU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluoro-4-hexylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-4-hexylphenol?
The IUPAC name of 2,3-difluoro-4-hexylphenol (CID 19910978) is 2,3-difluoro-4-hexylphenol.
What is the SMILES notation for 2,3-difluoro-4-hexylphenol?
The canonical SMILES for 2,3-difluoro-4-hexylphenol is CCCCCCc1ccc(O)c(F)c1F.
What is the InChIKey of 2,3-difluoro-4-hexylphenol?
The InChIKey is CRSQDBKLCIBFMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O/c1-2-3-4-5-6-9-7-8-10(15)12(14)11(9)13/h7-8,15H,2-6H2,1H3.
What are the key properties of 2,3-difluoro-4-hexylphenol?
2,3-difluoro-4-hexylphenol has a molecular weight of 214.26 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-4-hexylphenol is sourced from PubChem (CID 19910978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).