C23H40O — CID 23325139
2,3-dibutyl-4-nonylphenol (PubChem CID 23325139) has the molecular formula C23H40O and a molecular weight of 332.57 g/mol. Its IUPAC name is 2,3-dibutyl-4-nonylphenol.
| Compound Name | 2,3-dibutyl-4-nonylphenol |
|---|---|
| PubChem CID | 23325139 |
| Molecular Formula | C23H40O |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.31 |
| IUPAC Name | 2,3-dibutyl-4-nonylphenol |
| SMILES | CCCCCCCCCc1ccc(O)c(CCCC)c1CCCC |
| InChI | InChI=1S/C23H40O/c1-4-7-10-11-12-13-14-15-20-18-19-23(24)22(17-9-6-3)21(20)16-8-5-2/h18-19,24H,4-17H2,1-3H3 |
| InChIKey | UKRWHPPQCWIYBO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|