C17H28O — CID 66866454
2-pentyl-3,4-dipropylphenol (PubChem CID 66866454) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-pentyl-3,4-dipropylphenol.
| Compound Name | 2-pentyl-3,4-dipropylphenol |
|---|---|
| PubChem CID | 66866454 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2-pentyl-3,4-dipropylphenol |
| SMILES | CCCCCc1c(O)ccc(CCC)c1CCC |
| InChI | InChI=1S/C17H28O/c1-4-7-8-11-16-15(10-6-3)14(9-5-2)12-13-17(16)18/h12-13,18H,4-11H2,1-3H3 |
| InChIKey | MIQFJXPKTSCYFL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|