C19H34N2O — CID 160520570
3,4-bis(2-aminoethyl)-2-nonylphenol (PubChem CID 160520570) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 3,4-bis(2-aminoethyl)-2-nonylphenol.
| Compound Name | 3,4-bis(2-aminoethyl)-2-nonylphenol |
|---|---|
| PubChem CID | 160520570 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 3,4-bis(2-aminoethyl)-2-nonylphenol |
| SMILES | CCCCCCCCCc1c(O)ccc(CCN)c1CCN |
| InChI | InChI=1S/C19H34N2O/c1-2-3-4-5-6-7-8-9-18-17(13-15-21)16(12-14-20)10-11-19(18)22/h10-11,22H,2-9,12-15,20-21H2,1H3 |
| InChIKey | QUFGLTCTNOBFDM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|